C20H24N2O3 — CID 51856460
(2R)-N-(2,5-dimethoxyphenyl)-2-(4-methylphenyl)pyrrolidine-1-carboxamide (PubChem CID 51856460) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2R)-N-(2,5-dimethoxyphenyl)-2-(4-methylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(2,5-dimethoxyphenyl)-2-(4-methylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51856460 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2R)-N-(2,5-dimethoxyphenyl)-2-(4-methylphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)N2CCC[C@@H]2c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-14-6-8-15(9-7-14)18-5-4-12-22(18)20(23)21-17-13-16(24-2)10-11-19(17)25-3/h6-11,13,18H,4-5,12H2,1-3H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | LBLCSZIRVXBAFL-GOSISDBHSA-N |
| XLogP | 4.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |