C21H26N2O5 — CID 50747210
2-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 50747210) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 50747210 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(C2CCCN2C(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-25-16-9-7-14(8-10-16)17-6-5-11-23(17)21(24)22-15-12-18(26-2)20(28-4)19(13-15)27-3/h7-10,12-13,17H,5-6,11H2,1-4H3,(H,22,24) |
| InChIKey | RWXTUOWGWFXVLV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |