C17H21N5O3 — CID 95131115
(2S)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 95131115) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (2S)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 95131115 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)Nc2cnn(CC(N)=O)c2)cc1 |
| InChI | InChI=1S/C17H21N5O3/c1-25-14-6-4-12(5-7-14)15-3-2-8-22(15)17(24)20-13-9-19-21(10-13)11-16(18)23/h4-7,9-10,15H,2-3,8,11H2,1H3,(H2,18,23)(H,20,24)/t15-/m0/s1 |
| InChIKey | YCQYARPZMYJUBZ-HNNXBMFYSA-N |
| XLogP | 1.75 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |