C21H29N5O3 — CID 136511992
2-(4-methoxyphenyl)-N-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide (PubChem CID 136511992) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136511992 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(C2CCCN2C(=O)Nc2cnn(CCN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C21H29N5O3/c1-28-19-6-4-17(5-7-19)20-3-2-8-26(20)21(27)23-18-15-22-25(16-18)10-9-24-11-13-29-14-12-24/h4-7,15-16,20H,2-3,8-14H2,1H3,(H,23,27) |
| InChIKey | RIXPFSVPRJQBGY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |