C15H20N4O2S — CID 94031902
(2S)-N-[1-(2-methoxyethyl)pyrazol-4-yl]-2-thiophen-3-ylpyrrolidine-1-carboxamide (PubChem CID 94031902) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is (2S)-N-[1-(2-methoxyethyl)pyrazol-4-yl]-2-thiophen-3-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[1-(2-methoxyethyl)pyrazol-4-yl]-2-thiophen-3-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94031902 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2S)-N-[1-(2-methoxyethyl)pyrazol-4-yl]-2-thiophen-3-ylpyrrolidine-1-carboxamide |
| SMILES | COCCn1cc(NC(=O)N2CCC[C@H]2c2ccsc2)cn1 |
| InChI | InChI=1S/C15H20N4O2S/c1-21-7-6-18-10-13(9-16-18)17-15(20)19-5-2-3-14(19)12-4-8-22-11-12/h4,8-11,14H,2-3,5-7H2,1H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | ONRSOBUYJDQFOW-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |