C16H22N2O3S — CID 94117809
(4R)-1-(2-methoxyethyl)-4-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 94117809) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (4R)-1-(2-methoxyethyl)-4-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-(2-methoxyethyl)-4-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 94117809 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (4R)-1-(2-methoxyethyl)-4-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COCCN1C[C@H](C(=O)N2CCC[C@H]2c2ccsc2)CC1=O |
| InChI | InChI=1S/C16H22N2O3S/c1-21-7-6-17-10-13(9-15(17)19)16(20)18-5-2-3-14(18)12-4-8-22-11-12/h4,8,11,13-14H,2-3,5-7,9-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | JPVDGFONOILYPV-KGLIPLIRSA-N |
| XLogP | 1.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |