C19H21ClN2O2 — CID 51856616
(2S)-2-(4-chlorophenyl)-N-(2-methoxy-5-methylphenyl)pyrrolidine-1-carboxamide (PubChem CID 51856616) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-N-(2-methoxy-5-methylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-N-(2-methoxy-5-methylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51856616 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-N-(2-methoxy-5-methylphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)N1CCC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-13-5-10-18(24-2)16(12-13)21-19(23)22-11-3-4-17(22)14-6-8-15(20)9-7-14/h5-10,12,17H,3-4,11H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | FPRWIPCTIKFUPW-KRWDZBQOSA-N |
| XLogP | 5.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |