C19H21ClN2O2 — CID 50747134
2-(4-chlorophenyl)-N-(2-ethoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 50747134) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2-ethoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2-ethoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 50747134 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2-ethoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1CCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-2-24-18-8-4-3-6-16(18)21-19(23)22-13-5-7-17(22)14-9-11-15(20)12-10-14/h3-4,6,8-12,17H,2,5,7,13H2,1H3,(H,21,23) |
| InChIKey | DEXAXCLROQRVHM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |