C16H15N3O2S — CID 99354971
(2R)-N-(1,3-benzothiazol-6-yl)-2-(furan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 99354971) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is (2R)-N-(1,3-benzothiazol-6-yl)-2-(furan-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(1,3-benzothiazol-6-yl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99354971 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2R)-N-(1,3-benzothiazol-6-yl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc2ncsc2c1)N1CCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C16H15N3O2S/c20-16(18-11-5-6-12-15(9-11)22-10-17-12)19-7-1-3-13(19)14-4-2-8-21-14/h2,4-6,8-10,13H,1,3,7H2,(H,18,20)/t13-/m1/s1 |
| InChIKey | DDKOEZSPOPXNSK-CYBMUJFWSA-N |
| XLogP | 4.26 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |