C15H15BrN2O2 — CID 92500060
(2R)-N-(2-bromophenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 92500060) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is (2R)-N-(2-bromophenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(2-bromophenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 92500060 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (2R)-N-(2-bromophenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)N1CCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C15H15BrN2O2/c16-11-5-1-2-6-12(11)17-15(19)18-9-3-7-13(18)14-8-4-10-20-14/h1-2,4-6,8,10,13H,3,7,9H2,(H,17,19)/t13-/m1/s1 |
| InChIKey | MWPLTITVIZJBTC-CYBMUJFWSA-N |
| XLogP | 4.41 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |