C19H15ClF2N2OS — CID 95568951
[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone (PubChem CID 95568951) has the molecular formula C19H15ClF2N2OS and a molecular weight of 392.86 g/mol. Its IUPAC name is [(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone.
| Compound Name | [(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 95568951 |
| Molecular Formula | C19H15ClF2N2OS |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15ClF2N2OS/c20-12-10-14(22)13(21)9-11(12)19(25)24-8-4-3-6-16(24)18-23-15-5-1-2-7-17(15)26-18/h1-2,5,7,9-10,16H,3-4,6,8H2/t16-/m1/s1 |
| InChIKey | VHXQFFZTUAEZQX-MRXNPFEDSA-N |
| XLogP | 5.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|