C18H16ClN3OS — CID 55415894
[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-3-pyridinyl)methanone (PubChem CID 55415894) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-3-pyridinyl)methanone.
| Compound Name | [2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 55415894 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloro-3-pyridinyl)methanone |
| SMILES | O=C(c1cccnc1Cl)N1CCCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H16ClN3OS/c19-16-12(6-5-10-20-16)18(23)22-11-4-3-8-14(22)17-21-13-7-1-2-9-15(13)24-17/h1-2,5-7,9-10,14H,3-4,8,11H2 |
| InChIKey | VJBCJPVYPXQDBE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|