C16H15ClFNO2 — CID 51550766
2-(2-chloro-6-fluorophenyl)-1-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 51550766) has the molecular formula C16H15ClFNO2 and a molecular weight of 307.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 51550766 |
| Molecular Formula | C16H15ClFNO2 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[(2S)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCC[C@H]1c1ccco1 |
| InChI | InChI=1S/C16H15ClFNO2/c17-12-4-1-5-13(18)11(12)10-16(20)19-8-2-6-14(19)15-7-3-9-21-15/h1,3-5,7,9,14H,2,6,8,10H2/t14-/m0/s1 |
| InChIKey | AMLXVNIRZUBDGE-AWEZNQCLSA-N |
| XLogP | 3.98 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |