C22H26N2O5S — CID 110200183
5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenyl-1,5-diazecan-2-one (PubChem CID 110200183) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenyl-1,5-diazecan-2-one.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenyl-1,5-diazecan-2-one |
|---|---|
| PubChem CID | 110200183 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenyl-1,5-diazecan-2-one |
| SMILES | O=C1CC(c2ccccc2)N(S(=O)(=O)c2ccc3c(c2)OCCO3)CCCCCN1 |
| InChI | InChI=1S/C22H26N2O5S/c25-22-16-19(17-7-3-1-4-8-17)24(12-6-2-5-11-23-22)30(26,27)18-9-10-20-21(15-18)29-14-13-28-20/h1,3-4,7-10,15,19H,2,5-6,11-14,16H2,(H,23,25) |
| InChIKey | DYIFQLDURVZUKN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |