C16H21NO4S — CID 110871991
1-(1,3-benzodioxol-5-ylsulfonyl)-2-cyclopentylpyrrolidine (PubChem CID 110871991) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-2-cyclopentylpyrrolidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-2-cyclopentylpyrrolidine |
|---|---|
| PubChem CID | 110871991 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-2-cyclopentylpyrrolidine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)N1CCCC1C1CCCC1 |
| InChI | InChI=1S/C16H21NO4S/c18-22(19,13-7-8-15-16(10-13)21-11-20-15)17-9-3-6-14(17)12-4-1-2-5-12/h7-8,10,12,14H,1-6,9,11H2 |
| InChIKey | JLPQLHGNAYFBOP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |