C15H14N2O2S2 — CID 26947446
3-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]sulfonylbenzonitrile (PubChem CID 26947446) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 3-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 26947446 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCC[C@@H]2c2cccs2)c1 |
| InChI | InChI=1S/C15H14N2O2S2/c16-11-12-4-1-5-13(10-12)21(18,19)17-8-2-6-14(17)15-7-3-9-20-15/h1,3-5,7,9-10,14H,2,6,8H2/t14-/m1/s1 |
| InChIKey | DEPKKCSUDUOVPU-CQSZACIVSA-N |
| XLogP | 3.15 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |