C15H19N3O2S — CID 95768190
3-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile (PubChem CID 95768190) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile.
| Compound Name | 3-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 95768190 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-[[(3R,8aR)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile |
| SMILES | C[C@@H]1CN2CCC[C@@H]2CN1S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-12-10-17-7-3-5-14(17)11-18(12)21(19,20)15-6-2-4-13(8-15)9-16/h2,4,6,8,12,14H,3,5,7,10-11H2,1H3/t12-,14-/m1/s1 |
| InChIKey | VIQXKXXWVOMLFV-TZMCWYRMSA-N |
| XLogP | 1.42 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |