C14H18F2N2O2S — CID 71931391
2-(2,6-difluorophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 71931391) has the molecular formula C14H18F2N2O2S and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(2,6-difluorophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 71931391 |
| Molecular Formula | C14H18F2N2O2S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1CN2CCCC2CN1S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H18F2N2O2S/c1-10-8-17-7-3-4-11(17)9-18(10)21(19,20)14-12(15)5-2-6-13(14)16/h2,5-6,10-11H,3-4,7-9H2,1H3 |
| InChIKey | CIIOGAAYJPWCKF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |