C13H21N3O2S2 — CID 79942950
[5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]thiophen-2-yl]methanamine (PubChem CID 79942950) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]thiophen-2-yl]methanamine.
| Compound Name | [5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 79942950 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]thiophen-2-yl]methanamine |
| SMILES | CC1CN2CCCC2CN1S(=O)(=O)c1ccc(CN)s1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-10-8-15-6-2-3-11(15)9-16(10)20(17,18)13-5-4-12(7-14)19-13/h4-5,10-11H,2-3,6-9,14H2,1H3 |
| InChIKey | ZELGFTMAKQWWSX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |