C12H18ClN3O2S2 — CID 79477565
2-chloro-4-methyl-5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]-1,3-thiazole (PubChem CID 79477565) has the molecular formula C12H18ClN3O2S2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-chloro-4-methyl-5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]-1,3-thiazole.
| Compound Name | 2-chloro-4-methyl-5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79477565 |
| Molecular Formula | C12H18ClN3O2S2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-chloro-4-methyl-5-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)sulfonyl]-1,3-thiazole |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)N1CC2CCCN2CC1C |
| InChI | InChI=1S/C12H18ClN3O2S2/c1-8-6-15-5-3-4-10(15)7-16(8)20(17,18)11-9(2)14-12(13)19-11/h8,10H,3-7H2,1-2H3 |
| InChIKey | ZIAPHCXYYQXHDN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |