C14H19BrN2O2S — CID 78959724
2-(2-bromophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 78959724) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-(2-bromophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 78959724 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-(2-bromophenyl)sulfonyl-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1CN2CCCC2CN1S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C14H19BrN2O2S/c1-11-9-16-8-4-5-12(16)10-17(11)20(18,19)14-7-3-2-6-13(14)15/h2-3,6-7,11-12H,4-5,8-10H2,1H3 |
| InChIKey | KCFOFHRUMBKCPO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |