C11H14BrN3O3S — CID 77036015
1-(2-bromophenyl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide (PubChem CID 77036015) has the molecular formula C11H14BrN3O3S and a molecular weight of 348.22 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide.
| Compound Name | 1-(2-bromophenyl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 77036015 |
| Molecular Formula | C11H14BrN3O3S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-N'-hydroxypyrrolidine-2-carboximidamide |
| SMILES | NC(=NO)C1CCCN1S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C11H14BrN3O3S/c12-8-4-1-2-6-10(8)19(17,18)15-7-3-5-9(15)11(13)14-16/h1-2,4,6,9,16H,3,5,7H2,(H2,13,14) |
| InChIKey | YQJZXKXMZCQGRF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|