C15H19N3O2S — CID 112727897
3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)benzonitrile (PubChem CID 112727897) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)benzonitrile.
| Compound Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)benzonitrile |
|---|---|
| PubChem CID | 112727897 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCN3CCCCC3C2)c1 |
| InChI | InChI=1S/C15H19N3O2S/c16-11-13-4-3-6-15(10-13)21(19,20)18-9-8-17-7-2-1-5-14(17)12-18/h3-4,6,10,14H,1-2,5,7-9,12H2 |
| InChIKey | ISTTZNIQDYYQHV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |