C16H21N3O2S — CID 129425478
3-[[(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile (PubChem CID 129425478) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-[[(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile.
| Compound Name | 3-[[(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 129425478 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-[[(3R,8aS)-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]benzonitrile |
| SMILES | CC[C@@H]1CN2CCC[C@H]2CN1S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-2-14-11-18-8-4-6-15(18)12-19(14)22(20,21)16-7-3-5-13(9-16)10-17/h3,5,7,9,14-15H,2,4,6,8,11-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | LVQAQTGYYNSELA-CABCVRRESA-N |
| XLogP | 1.81 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |