C14H20FN3O2S — CID 95780310
(3R,8aR)-3-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 95780310) has the molecular formula C14H20FN3O2S and a molecular weight of 313.40 g/mol. Its IUPAC name is (3R,8aR)-3-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3R,8aR)-3-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 95780310 |
| Molecular Formula | C14H20FN3O2S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3R,8aR)-3-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC[C@@H]1CN2CCC[C@@H]2CN1S(=O)(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C14H20FN3O2S/c1-2-12-9-17-5-3-4-13(17)10-18(12)21(19,20)14-6-11(15)7-16-8-14/h6-8,12-13H,2-5,9-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | WNSHHZIFWCTUCE-CHWSQXEVSA-N |
| XLogP | 1.47 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |