C11H17ClFN3O2S — CID 119991049
1-[1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119991049) has the molecular formula C11H17ClFN3O2S and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-[1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119991049 |
| Molecular Formula | C11H17ClFN3O2S |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-[1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCCN1S(=O)(=O)c1cncc(F)c1.Cl |
| InChI | InChI=1S/C11H16FN3O2S.ClH/c1-13-7-10-3-2-4-15(10)18(16,17)11-5-9(12)6-14-8-11;/h5-6,8,10,13H,2-4,7H2,1H3;1H |
| InChIKey | ZPLXRKVDBYOKPZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |