C12H18Cl2FN3O — CID 119649427
(5-fluoro-3-pyridinyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride (PubChem CID 119649427) has the molecular formula C12H18Cl2FN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride.
| Compound Name | (5-fluoro-3-pyridinyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119649427 |
| Molecular Formula | C12H18Cl2FN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (5-fluoro-3-pyridinyl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;dihydrochloride |
| SMILES | CNCC1CCCN1C(=O)c1cncc(F)c1.Cl.Cl |
| InChI | InChI=1S/C12H16FN3O.2ClH/c1-14-8-11-3-2-4-16(11)12(17)9-5-10(13)7-15-6-9;;/h5-7,11,14H,2-4,8H2,1H3;2*1H |
| InChIKey | WWXQYAFOEUPYRT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |