C12H16FN3O — CID 113265528
(5-fluoro-3-pyridinyl)-[3-(methylamino)piperidin-1-yl]methanone (PubChem CID 113265528) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl)-[3-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (5-fluoro-3-pyridinyl)-[3-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113265528 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (5-fluoro-3-pyridinyl)-[3-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCCN(C(=O)c2cncc(F)c2)C1 |
| InChI | InChI=1S/C12H16FN3O/c1-14-11-3-2-4-16(8-11)12(17)9-5-10(13)7-15-6-9/h5-7,11,14H,2-4,8H2,1H3 |
| InChIKey | WKJRDPYYWBYKQN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |