C13H17FN2O — CID 62535610
(4-fluorophenyl)-[3-(methylamino)piperidin-1-yl]methanone (PubChem CID 62535610) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[3-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 62535610 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (4-fluorophenyl)-[3-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H17FN2O/c1-15-12-3-2-8-16(9-12)13(17)10-4-6-11(14)7-5-10/h4-7,12,15H,2-3,8-9H2,1H3 |
| InChIKey | NDYWQMFEQPCZMN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |