C14H17F3N2OS — CID 119491013
[3-(methylamino)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone (PubChem CID 119491013) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone.
| Compound Name | [3-(methylamino)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 119491013 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-[4-(trifluoromethylsulfanyl)phenyl]methanone |
| SMILES | CNC1CCCN(C(=O)c2ccc(SC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H17F3N2OS/c1-18-11-3-2-8-19(9-11)13(20)10-4-6-12(7-5-10)21-14(15,16)17/h4-7,11,18H,2-3,8-9H2,1H3 |
| InChIKey | YHHZHZQDURGQPG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |