C13H16BrFN2O — CID 129380585
(3-bromo-5-fluorophenyl)-[(2R)-2-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 129380585) has the molecular formula C13H16BrFN2O and a molecular weight of 315.19 g/mol. Its IUPAC name is (3-bromo-5-fluorophenyl)-[(2R)-2-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-bromo-5-fluorophenyl)-[(2R)-2-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 129380585 |
| Molecular Formula | C13H16BrFN2O |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | (3-bromo-5-fluorophenyl)-[(2R)-2-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNC[C@H]1CCCN1C(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H16BrFN2O/c1-16-8-12-3-2-4-17(12)13(18)9-5-10(14)7-11(15)6-9/h5-7,12,16H,2-4,8H2,1H3/t12-/m1/s1 |
| InChIKey | FUNCCQWGUGTOGB-GFCCVEGCSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |