C17H21NO4S2 — CID 134035739
1-[4-(2-methoxyethoxy)phenyl]sulfonyl-2-thiophen-2-ylpyrrolidine (PubChem CID 134035739) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 134035739 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-2-thiophen-2-ylpyrrolidine |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCCC2c2cccs2)cc1 |
| InChI | InChI=1S/C17H21NO4S2/c1-21-11-12-22-14-6-8-15(9-7-14)24(19,20)18-10-2-4-16(18)17-5-3-13-23-17/h3,5-9,13,16H,2,4,10-12H2,1H3 |
| InChIKey | GFBWOEVLCKZEQJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|