C17H24N2O5S — CID 46596105
N-cyclopropyl-1-[4-(2-methoxyethoxy)phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 46596105) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-cyclopropyl-1-[4-(2-methoxyethoxy)phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-[4-(2-methoxyethoxy)phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46596105 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-cyclopropyl-1-[4-(2-methoxyethoxy)phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCCC2C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-23-11-12-24-14-6-8-15(9-7-14)25(21,22)19-10-2-3-16(19)17(20)18-13-4-5-13/h6-9,13,16H,2-5,10-12H2,1H3,(H,18,20) |
| InChIKey | RHKTXJGRWSMFTK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|