C18H27N3O5S2 — CID 43062096
N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 43062096) has the molecular formula C18H27N3O5S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43062096 |
| Molecular Formula | C18H27N3O5S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2CCCC2C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H27N3O5S2/c1-3-20(4-2)27(23,24)15-9-11-16(12-10-15)28(25,26)21-13-5-6-17(21)18(22)19-14-7-8-14/h9-12,14,17H,3-8,13H2,1-2H3,(H,19,22) |
| InChIKey | WCXSFVACNAYKTG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |