C18H25BrN2O3S — CID 24617140
1-(4-bromophenyl)sulfonyl-N-cycloheptylpyrrolidine-2-carboxamide (PubChem CID 24617140) has the molecular formula C18H25BrN2O3S and a molecular weight of 429.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-cycloheptylpyrrolidine-2-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-cycloheptylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24617140 |
| Molecular Formula | C18H25BrN2O3S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-cycloheptylpyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1CCCN1S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H25BrN2O3S/c19-14-9-11-16(12-10-14)25(23,24)21-13-5-8-17(21)18(22)20-15-6-3-1-2-4-7-15/h9-12,15,17H,1-8,13H2,(H,20,22) |
| InChIKey | CPVFMMPMHFBJNO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |