C15H24N2O4S — CID 120715200
1-[4-(2-methoxyethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine (PubChem CID 120715200) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine.
| Compound Name | 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 120715200 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(OCCOC)cc2)C1 |
| InChI | InChI=1S/C15H24N2O4S/c1-16-13-4-3-9-17(12-13)22(18,19)15-7-5-14(6-8-15)21-11-10-20-2/h5-8,13,16H,3-4,9-12H2,1-2H3 |
| InChIKey | MTUVPPQUHRGGLX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|