C16H27ClN2O4S — CID 119978169
1-[1-[4-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119978169) has the molecular formula C16H27ClN2O4S and a molecular weight of 378.92 g/mol. Its IUPAC name is 1-[1-[4-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-[4-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119978169 |
| Molecular Formula | C16H27ClN2O4S |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[1-[4-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCN(S(=O)(=O)c2ccc(OCCOC)cc2)CC1.Cl |
| InChI | InChI=1S/C16H26N2O4S.ClH/c1-17-13-14-7-9-18(10-8-14)23(19,20)16-5-3-15(4-6-16)22-12-11-21-2;/h3-6,14,17H,7-13H2,1-2H3;1H |
| InChIKey | MJLJVTRACCULOO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|