C20H33ClN2O3S — CID 119987701
N-(cyclopropylmethyl)-1-(4-pentoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119987701) has the molecular formula C20H33ClN2O3S and a molecular weight of 417.02 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(4-pentoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | N-(cyclopropylmethyl)-1-(4-pentoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119987701 |
| Molecular Formula | C20H33ClN2O3S |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(4-pentoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | CCCCCOc1ccc(S(=O)(=O)N2CCC(NCC3CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C20H32N2O3S.ClH/c1-2-3-4-15-25-19-7-9-20(10-8-19)26(23,24)22-13-11-18(12-14-22)21-16-17-5-6-17;/h7-10,17-18,21H,2-6,11-16H2,1H3;1H |
| InChIKey | WVCWANHWKULXJB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|