C24H34N2O6S — CID 18767785
4-[3-[[1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]amino]-2-hydroxypropoxy]phenol (PubChem CID 18767785) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is 4-[3-[[1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]amino]-2-hydroxypropoxy]phenol.
| Compound Name | 4-[3-[[1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]amino]-2-hydroxypropoxy]phenol |
|---|---|
| PubChem CID | 18767785 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 4-[3-[[1-(4-butoxyphenyl)sulfonylpiperidin-4-yl]amino]-2-hydroxypropoxy]phenol |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCC(NCC(O)COc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H34N2O6S/c1-2-3-16-31-22-8-10-24(11-9-22)33(29,30)26-14-12-19(13-15-26)25-17-21(28)18-32-23-6-4-20(27)5-7-23/h4-11,19,21,25,27-28H,2-3,12-18H2,1H3 |
| InChIKey | MHXSHTNSMDWWQO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|