C25H30N2O5S — CID 70000212
4-[(2R)-2-hydroxy-3-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methylamino]propoxy]phenol (PubChem CID 70000212) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-3-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methylamino]propoxy]phenol.
| Compound Name | 4-[(2R)-2-hydroxy-3-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methylamino]propoxy]phenol |
|---|---|
| PubChem CID | 70000212 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methylamino]propoxy]phenol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCC(CNC[C@@H](O)COc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C25H30N2O5S/c28-22-6-8-24(9-7-22)32-18-23(29)17-26-16-19-11-13-27(14-12-19)33(30,31)25-10-5-20-3-1-2-4-21(20)15-25/h1-10,15,19,23,26,28-29H,11-14,16-18H2/t23-/m1/s1 |
| InChIKey | BXNBIYJNFZWMBU-HSZRJFAPSA-N |
| XLogP | 2.98 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |