C28H41N3O6S — CID 10302672
N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]heptanamide (PubChem CID 10302672) has the molecular formula C28H41N3O6S and a molecular weight of 547.72 g/mol. Its IUPAC name is N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]heptanamide.
| Compound Name | N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]heptanamide |
|---|---|
| PubChem CID | 10302672 |
| Molecular Formula | C28H41N3O6S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(S(=O)(=O)N2CCC(CNC[C@H](O)COc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H41N3O6S/c1-2-3-4-5-6-28(34)30-23-7-13-27(14-8-23)38(35,36)31-17-15-22(16-18-31)19-29-20-25(33)21-37-26-11-9-24(32)10-12-26/h7-14,22,25,29,32-33H,2-6,15-21H2,1H3,(H,30,34)/t25-/m0/s1 |
| InChIKey | UXFIUHCIAPLNFN-VWLOTQADSA-N |
| XLogP | 3.73 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|