C34H52N4O5S — CID 142109010
1-hexyl-3-[4-[4-[[[(2R)-3-[2-(4-hydroxyphenyl)cyclopentyl]-2-methoxypropyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea (PubChem CID 142109010) has the molecular formula C34H52N4O5S and a molecular weight of 628.88 g/mol. Its IUPAC name is 1-hexyl-3-[4-[4-[[[(2R)-3-[2-(4-hydroxyphenyl)cyclopentyl]-2-methoxypropyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea.
| Compound Name | 1-hexyl-3-[4-[4-[[[(2R)-3-[2-(4-hydroxyphenyl)cyclopentyl]-2-methoxypropyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea |
|---|---|
| PubChem CID | 142109010 |
| Molecular Formula | C34H52N4O5S |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 1-hexyl-3-[4-[4-[[[(2R)-3-[2-(4-hydroxyphenyl)cyclopentyl]-2-methoxypropyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)N2CCC(CNC[C@@H](CC3CCCC3c3ccc(O)cc3)OC)CC2)cc1 |
| InChI | InChI=1S/C34H52N4O5S/c1-3-4-5-6-20-36-34(40)37-29-12-16-32(17-13-29)44(41,42)38-21-18-26(19-22-38)24-35-25-31(43-2)23-28-8-7-9-33(28)27-10-14-30(39)15-11-27/h10-17,26,28,31,33,35,39H,3-9,18-25H2,1-2H3,(H2,36,37,40)/t28?,31-,33?/m1/s1 |
| InChIKey | FGUXVJHGANVQKO-OSYDKSERSA-N |
| XLogP | 6.07 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|