C30H45N3O6S — CID 10257535
N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]nonanamide (PubChem CID 10257535) has the molecular formula C30H45N3O6S and a molecular weight of 575.77 g/mol. Its IUPAC name is N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]nonanamide.
| Compound Name | N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]nonanamide |
|---|---|
| PubChem CID | 10257535 |
| Molecular Formula | C30H45N3O6S |
| Molecular Weight | 575.77 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | N-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]nonanamide |
| SMILES | CCCCCCCCC(=O)Nc1ccc(S(=O)(=O)N2CCC(CNC[C@H](O)COc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H45N3O6S/c1-2-3-4-5-6-7-8-30(36)32-25-9-15-29(16-10-25)40(37,38)33-19-17-24(18-20-33)21-31-22-27(35)23-39-28-13-11-26(34)12-14-28/h9-16,24,27,31,34-35H,2-8,17-23H2,1H3,(H,32,36)/t27-/m0/s1 |
| InChIKey | IVRNJAWMAKJWBE-MHZLTWQESA-N |
| XLogP | 4.51 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|