C30H42N4O6S2 — CID 5172520
N,N'-bis[4-(4-methylpiperidin-1-yl)sulfonylphenyl]hexanediamide (PubChem CID 5172520) has the molecular formula C30H42N4O6S2 and a molecular weight of 618.82 g/mol. Its IUPAC name is N,N'-bis[4-(4-methylpiperidin-1-yl)sulfonylphenyl]hexanediamide.
| Compound Name | N,N'-bis[4-(4-methylpiperidin-1-yl)sulfonylphenyl]hexanediamide |
|---|---|
| PubChem CID | 5172520 |
| Molecular Formula | C30H42N4O6S2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | N,N'-bis[4-(4-methylpiperidin-1-yl)sulfonylphenyl]hexanediamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=O)CCCCC(=O)Nc3ccc(S(=O)(=O)N4CCC(C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H42N4O6S2/c1-23-15-19-33(20-16-23)41(37,38)27-11-7-25(8-12-27)31-29(35)5-3-4-6-30(36)32-26-9-13-28(14-10-26)42(39,40)34-21-17-24(2)18-22-34/h7-14,23-24H,3-6,15-22H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | CHMCYFYTIFTYTK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|