C30H42N4O8S2 — CID 17080112
N,N'-bis(4-morpholin-4-ylsulfonylphenyl)decanediamide (PubChem CID 17080112) has the molecular formula C30H42N4O8S2 and a molecular weight of 650.82 g/mol. Its IUPAC name is N,N'-bis(4-morpholin-4-ylsulfonylphenyl)decanediamide.
| Compound Name | N,N'-bis(4-morpholin-4-ylsulfonylphenyl)decanediamide |
|---|---|
| PubChem CID | 17080112 |
| Molecular Formula | C30H42N4O8S2 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | N,N'-bis(4-morpholin-4-ylsulfonylphenyl)decanediamide |
| SMILES | O=C(CCCCCCCCC(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H42N4O8S2/c35-29(31-25-9-13-27(14-10-25)43(37,38)33-17-21-41-22-18-33)7-5-3-1-2-4-6-8-30(36)32-26-11-15-28(16-12-26)44(39,40)34-19-23-42-24-20-34/h9-16H,1-8,17-24H2,(H,31,35)(H,32,36) |
| InChIKey | QISNJSJIHVOVPQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|