C20H27N5O4S — CID 108800691
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)butanamide (PubChem CID 108800691) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 108800691 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C20H27N5O4S/c1-15-14-16(2)23-20(22-15)21-9-3-4-19(26)24-17-5-7-18(8-6-17)30(27,28)25-10-12-29-13-11-25/h5-8,14H,3-4,9-13H2,1-2H3,(H,24,26)(H,21,22,23) |
| InChIKey | PYDRXQBIVATOEH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|