C16H21N5O3S — CID 108787748
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-sulfamoylphenyl)butanamide (PubChem CID 108787748) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-sulfamoylphenyl)butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 108787748 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-(4-sulfamoylphenyl)butanamide |
| SMILES | Cc1cc(C)nc(NCCCC(=O)Nc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C16H21N5O3S/c1-11-10-12(2)20-16(19-11)18-9-3-4-15(22)21-13-5-7-14(8-6-13)25(17,23)24/h5-8,10H,3-4,9H2,1-2H3,(H,21,22)(H2,17,23,24)(H,18,19,20) |
| InChIKey | DUKAZCSQWOJHIC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|