C23H27N5O — CID 108800818
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-(4-methylanilino)phenyl]butanamide (PubChem CID 108800818) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-(4-methylanilino)phenyl]butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-(4-methylanilino)phenyl]butanamide |
|---|---|
| PubChem CID | 108800818 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-(4-methylanilino)phenyl]butanamide |
| SMILES | Cc1ccc(Nc2ccccc2NC(=O)CCCNc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H27N5O/c1-16-10-12-19(13-11-16)27-20-7-4-5-8-21(20)28-22(29)9-6-14-24-23-25-17(2)15-18(3)26-23/h4-5,7-8,10-13,15,27H,6,9,14H2,1-3H3,(H,28,29)(H,24,25,26) |
| InChIKey | TXESQCVQJQTNQX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|