C23H29N7O — CID 108810270
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]butanamide (PubChem CID 108810270) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 108810270 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]butanamide |
| SMILES | CCc1ccc(Nc2cc(C)ncn2)cc1NC(=O)CCCNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C23H29N7O/c1-5-18-8-9-19(29-21-12-15(2)25-14-26-21)13-20(18)30-22(31)7-6-10-24-23-27-16(3)11-17(4)28-23/h8-9,11-14H,5-7,10H2,1-4H3,(H,30,31)(H,24,27,28)(H,25,26,29) |
| InChIKey | ZGZRSOXHDGCPKJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|