C22H20Cl2N4O — CID 108771250
(E)-3-(3,4-dichlorophenyl)-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 108771250) has the molecular formula C22H20Cl2N4O and a molecular weight of 427.34 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108771250 |
| Molecular Formula | C22H20Cl2N4O |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-ethyl-5-[(6-methylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | CCc1ccc(Nc2cc(C)ncn2)cc1NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N4O/c1-3-16-6-7-17(27-21-10-14(2)25-13-26-21)12-20(16)28-22(29)9-5-15-4-8-18(23)19(24)11-15/h4-13H,3H2,1-2H3,(H,28,29)(H,25,26,27)/b9-5+ |
| InChIKey | AIIFDBQGHIVFHP-WEVVVXLNSA-N |
| XLogP | 6.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|